C15H13BrN6O — CID 138700937
2-[(6-amino-8-bromo-2-ethoxypurin-9-yl)methyl]benzonitrile (PubChem CID 138700937) has the molecular formula C15H13BrN6O and a molecular weight of 373.21 g/mol. Its IUPAC name is 2-[(6-amino-8-bromo-2-ethoxypurin-9-yl)methyl]benzonitrile.
| Compound Name | 2-[(6-amino-8-bromo-2-ethoxypurin-9-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 138700937 |
| Molecular Formula | C15H13BrN6O |
| Molecular Weight | 373.21 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | 2-[(6-amino-8-bromo-2-ethoxypurin-9-yl)methyl]benzonitrile |
| SMILES | CCOc1nc(N)c2nc(Br)n(Cc3ccccc3C#N)c2n1 |
| InChI | InChI=1S/C15H13BrN6O/c1-2-23-15-20-12(18)11-13(21-15)22(14(16)19-11)8-10-6-4-3-5-9(10)7-17/h3-6H,2,8H2,1H3,(H2,18,20,21) |
| InChIKey | AFOWEHYQJVGPPX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 102.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.21 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |