C17H22BrN7O2 — CID 166713874
8-bromo-2-ethoxy-9-[[2-[3-(methylamino)propoxy]-3-pyridinyl]methyl]purin-6-amine (PubChem CID 166713874) has the molecular formula C17H22BrN7O2 and a molecular weight of 436.31 g/mol. Its IUPAC name is 8-bromo-2-ethoxy-9-[[2-[3-(methylamino)propoxy]-3-pyridinyl]methyl]purin-6-amine.
| Compound Name | 8-bromo-2-ethoxy-9-[[2-[3-(methylamino)propoxy]-3-pyridinyl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 166713874 |
| Molecular Formula | C17H22BrN7O2 |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 8-bromo-2-ethoxy-9-[[2-[3-(methylamino)propoxy]-3-pyridinyl]methyl]purin-6-amine |
| SMILES | CCOc1nc(N)c2nc(Br)n(Cc3cccnc3OCCCNC)c2n1 |
| InChI | InChI=1S/C17H22BrN7O2/c1-3-26-17-23-13(19)12-14(24-17)25(16(18)22-12)10-11-6-4-8-21-15(11)27-9-5-7-20-2/h4,6,8,20H,3,5,7,9-10H2,1-2H3,(H2,19,23,24) |
| InChIKey | YBMWAMSJMHINNK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|