C17H19F2N5O — CID 68855168
2-butoxy-9-[(2,6-difluorophenyl)methyl]-8-methylpurin-6-amine (PubChem CID 68855168) has the molecular formula C17H19F2N5O and a molecular weight of 347.37 g/mol. Its IUPAC name is 2-butoxy-9-[(2,6-difluorophenyl)methyl]-8-methylpurin-6-amine.
| Compound Name | 2-butoxy-9-[(2,6-difluorophenyl)methyl]-8-methylpurin-6-amine |
|---|---|
| PubChem CID | 68855168 |
| Molecular Formula | C17H19F2N5O |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 2-butoxy-9-[(2,6-difluorophenyl)methyl]-8-methylpurin-6-amine |
| SMILES | CCCCOc1nc(N)c2nc(C)n(Cc3c(F)cccc3F)c2n1 |
| InChI | InChI=1S/C17H19F2N5O/c1-3-4-8-25-17-22-15(20)14-16(23-17)24(10(2)21-14)9-11-12(18)6-5-7-13(11)19/h5-7H,3-4,8-9H2,1-2H3,(H2,20,22,23) |
| InChIKey | PYAQQEKBMHNOMH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|