C16H18N6O2 — CID 71154032
9-benzyl-2-(2-methoxyethoxy)-8-(methylideneamino)purin-6-amine (PubChem CID 71154032) has the molecular formula C16H18N6O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is 9-benzyl-2-(2-methoxyethoxy)-8-(methylideneamino)purin-6-amine.
| Compound Name | 9-benzyl-2-(2-methoxyethoxy)-8-(methylideneamino)purin-6-amine |
|---|---|
| PubChem CID | 71154032 |
| Molecular Formula | C16H18N6O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 9-benzyl-2-(2-methoxyethoxy)-8-(methylideneamino)purin-6-amine |
| SMILES | C=Nc1nc2c(N)nc(OCCOC)nc2n1Cc1ccccc1 |
| InChI | InChI=1S/C16H18N6O2/c1-18-15-19-12-13(17)20-16(24-9-8-23-2)21-14(12)22(15)10-11-6-4-3-5-7-11/h3-7H,1,8-10H2,2H3,(H2,17,20,21) |
| InChIKey | NMTITMZBQCNSFC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|