C22H31BrN5O6P — CID 87621115
[1-[2-[6-amino-8-bromo-2-(2-methoxyethoxy)purin-9-yl]ethoxy]-2-phenylethyl]-butan-2-yloxyphosphinic acid (PubChem CID 87621115) has the molecular formula C22H31BrN5O6P and a molecular weight of 572.40 g/mol. Its IUPAC name is [1-[2-[6-amino-8-bromo-2-(2-methoxyethoxy)purin-9-yl]ethoxy]-2-phenylethyl]-butan-2-yloxyphosphinic acid.
| Compound Name | [1-[2-[6-amino-8-bromo-2-(2-methoxyethoxy)purin-9-yl]ethoxy]-2-phenylethyl]-butan-2-yloxyphosphinic acid |
|---|---|
| PubChem CID | 87621115 |
| Molecular Formula | C22H31BrN5O6P |
| Molecular Weight | 572.40 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | [1-[2-[6-amino-8-bromo-2-(2-methoxyethoxy)purin-9-yl]ethoxy]-2-phenylethyl]-butan-2-yloxyphosphinic acid |
| SMILES | CCC(C)OP(=O)(O)C(Cc1ccccc1)OCCn1c(Br)nc2c(N)nc(OCCOC)nc21 |
| InChI | InChI=1S/C22H31BrN5O6P/c1-4-15(2)34-35(29,30)17(14-16-8-6-5-7-9-16)32-11-10-28-20-18(25-21(28)23)19(24)26-22(27-20)33-13-12-31-3/h5-9,15,17H,4,10-14H2,1-3H3,(H,29,30)(H2,24,26,27) |
| InChIKey | CBAABBAZJMARJL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|