C18H24N5O8P — CID 68844152
[1-[2-[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]ethoxy]-2-phenoxyethyl]phosphonic acid (PubChem CID 68844152) has the molecular formula C18H24N5O8P and a molecular weight of 469.39 g/mol. Its IUPAC name is [1-[2-[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]ethoxy]-2-phenoxyethyl]phosphonic acid.
| Compound Name | [1-[2-[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]ethoxy]-2-phenoxyethyl]phosphonic acid |
|---|---|
| PubChem CID | 68844152 |
| Molecular Formula | C18H24N5O8P |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | [1-[2-[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]ethoxy]-2-phenoxyethyl]phosphonic acid |
| SMILES | COCCOc1nc(N)c2[nH]c(=O)n(CCOC(COc3ccccc3)P(=O)(O)O)c2n1 |
| InChI | InChI=1S/C18H24N5O8P/c1-28-9-10-30-17-21-15(19)14-16(22-17)23(18(24)20-14)7-8-29-13(32(25,26)27)11-31-12-5-3-2-4-6-12/h2-6,13H,7-11H2,1H3,(H,20,24)(H2,19,21,22)(H2,25,26,27) |
| InChIKey | FXDWBPQSEGUQEO-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 184.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|