C16H28N5O6P — CID 87607118
1-[2-[6-amino-2-(2-methoxyethoxy)purin-9-yl]ethoxy]ethyl-butan-2-yloxyphosphinic acid (PubChem CID 87607118) has the molecular formula C16H28N5O6P and a molecular weight of 417.40 g/mol. Its IUPAC name is 1-[2-[6-amino-2-(2-methoxyethoxy)purin-9-yl]ethoxy]ethyl-butan-2-yloxyphosphinic acid.
| Compound Name | 1-[2-[6-amino-2-(2-methoxyethoxy)purin-9-yl]ethoxy]ethyl-butan-2-yloxyphosphinic acid |
|---|---|
| PubChem CID | 87607118 |
| Molecular Formula | C16H28N5O6P |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 1-[2-[6-amino-2-(2-methoxyethoxy)purin-9-yl]ethoxy]ethyl-butan-2-yloxyphosphinic acid |
| SMILES | CCC(C)OP(=O)(O)C(C)OCCn1cnc2c(N)nc(OCCOC)nc21 |
| InChI | InChI=1S/C16H28N5O6P/c1-5-11(2)27-28(22,23)12(3)25-7-6-21-10-18-13-14(17)19-16(20-15(13)21)26-9-8-24-4/h10-12H,5-9H2,1-4H3,(H,22,23)(H2,17,19,20) |
| InChIKey | PWSQDLZZXSXJON-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|