C20H28N5O2P — CID 141447965
9-[[4-(diethylphosphanylmethyl)phenyl]methyl]-2-(2-methoxyethoxy)purin-6-amine (PubChem CID 141447965) has the molecular formula C20H28N5O2P and a molecular weight of 401.45 g/mol. Its IUPAC name is 9-[[4-(diethylphosphanylmethyl)phenyl]methyl]-2-(2-methoxyethoxy)purin-6-amine.
| Compound Name | 9-[[4-(diethylphosphanylmethyl)phenyl]methyl]-2-(2-methoxyethoxy)purin-6-amine |
|---|---|
| PubChem CID | 141447965 |
| Molecular Formula | C20H28N5O2P |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 9-[[4-(diethylphosphanylmethyl)phenyl]methyl]-2-(2-methoxyethoxy)purin-6-amine |
| SMILES | CCP(CC)Cc1ccc(Cn2cnc3c(N)nc(OCCOC)nc32)cc1 |
| InChI | InChI=1S/C20H28N5O2P/c1-4-28(5-2)13-16-8-6-15(7-9-16)12-25-14-22-17-18(21)23-20(24-19(17)25)27-11-10-26-3/h6-9,14H,4-5,10-13H2,1-3H3,(H2,21,23,24) |
| InChIKey | ZHLUBKRUJDKMKL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|