C13H13FN6O — CID 138700825
2-ethoxy-9-[(6-fluoro-3-pyridinyl)methyl]purin-6-amine (PubChem CID 138700825) has the molecular formula C13H13FN6O and a molecular weight of 288.29 g/mol. Its IUPAC name is 2-ethoxy-9-[(6-fluoro-3-pyridinyl)methyl]purin-6-amine.
| Compound Name | 2-ethoxy-9-[(6-fluoro-3-pyridinyl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 138700825 |
| Molecular Formula | C13H13FN6O |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-ethoxy-9-[(6-fluoro-3-pyridinyl)methyl]purin-6-amine |
| SMILES | CCOc1nc(N)c2ncn(Cc3ccc(F)nc3)c2n1 |
| InChI | InChI=1S/C13H13FN6O/c1-2-21-13-18-11(15)10-12(19-13)20(7-17-10)6-8-3-4-9(14)16-5-8/h3-5,7H,2,6H2,1H3,(H2,15,18,19) |
| InChIKey | WPLPKPXQLNCLLN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|