C19H24N6O — CID 138700891
2-(cyclopropylmethoxy)-9-[[4-[(dimethylamino)methyl]phenyl]methyl]purin-6-amine (PubChem CID 138700891) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-(cyclopropylmethoxy)-9-[[4-[(dimethylamino)methyl]phenyl]methyl]purin-6-amine.
| Compound Name | 2-(cyclopropylmethoxy)-9-[[4-[(dimethylamino)methyl]phenyl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 138700891 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 2-(cyclopropylmethoxy)-9-[[4-[(dimethylamino)methyl]phenyl]methyl]purin-6-amine |
| SMILES | CN(C)Cc1ccc(Cn2cnc3c(N)nc(OCC4CC4)nc32)cc1 |
| InChI | InChI=1S/C19H24N6O/c1-24(2)9-13-3-5-14(6-4-13)10-25-12-21-16-17(20)22-19(23-18(16)25)26-11-15-7-8-15/h3-6,12,15H,7-11H2,1-2H3,(H2,20,22,23) |
| InChIKey | DXCLZFDCJBDFEH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |