C16H18N6 — CID 178028928
2-(cyclopropylmethyl)-9-[(4-methyl-2-pyridinyl)methyl]purin-6-amine (PubChem CID 178028928) has the molecular formula C16H18N6 and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-9-[(4-methyl-2-pyridinyl)methyl]purin-6-amine.
| Compound Name | 2-(cyclopropylmethyl)-9-[(4-methyl-2-pyridinyl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 178028928 |
| Molecular Formula | C16H18N6 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-(cyclopropylmethyl)-9-[(4-methyl-2-pyridinyl)methyl]purin-6-amine |
| SMILES | Cc1ccnc(Cn2cnc3c(N)nc(CC4CC4)nc32)c1 |
| InChI | InChI=1S/C16H18N6/c1-10-4-5-18-12(6-10)8-22-9-19-14-15(17)20-13(21-16(14)22)7-11-2-3-11/h4-6,9,11H,2-3,7-8H2,1H3,(H2,17,20,21) |
| InChIKey | KEHODVBBHZFUDA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |