C15H14N6 — CID 129244073
9-(1H-indol-7-ylmethyl)-2-methylpurin-6-amine (PubChem CID 129244073) has the molecular formula C15H14N6 and a molecular weight of 278.32 g/mol. Its IUPAC name is 9-(1H-indol-7-ylmethyl)-2-methylpurin-6-amine.
| Compound Name | 9-(1H-indol-7-ylmethyl)-2-methylpurin-6-amine |
|---|---|
| PubChem CID | 129244073 |
| Molecular Formula | C15H14N6 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 9-(1H-indol-7-ylmethyl)-2-methylpurin-6-amine |
| SMILES | Cc1nc(N)c2ncn(Cc3cccc4cc[nH]c34)c2n1 |
| InChI | InChI=1S/C15H14N6/c1-9-19-14(16)13-15(20-9)21(8-18-13)7-11-4-2-3-10-5-6-17-12(10)11/h2-6,8,17H,7H2,1H3,(H2,16,19,20) |
| InChIKey | GMPYMPUULATPLO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |