C15H16N6 — CID 167978863
9-[(2-cyclopropylphenyl)methyl]purine-2,6-diamine (PubChem CID 167978863) has the molecular formula C15H16N6 and a molecular weight of 280.34 g/mol. Its IUPAC name is 9-[(2-cyclopropylphenyl)methyl]purine-2,6-diamine.
| Compound Name | 9-[(2-cyclopropylphenyl)methyl]purine-2,6-diamine |
|---|---|
| PubChem CID | 167978863 |
| Molecular Formula | C15H16N6 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 9-[(2-cyclopropylphenyl)methyl]purine-2,6-diamine |
| SMILES | Nc1nc(N)c2ncn(Cc3ccccc3C3CC3)c2n1 |
| InChI | InChI=1S/C15H16N6/c16-13-12-14(20-15(17)19-13)21(8-18-12)7-10-3-1-2-4-11(10)9-5-6-9/h1-4,8-9H,5-7H2,(H4,16,17,19,20) |
| InChIKey | AVTVZYRFEXPORC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |