C11H12Cl2N6 — CID 141031122
9-phenylpurine-2,6-diamine;dihydrochloride (PubChem CID 141031122) has the molecular formula C11H12Cl2N6 and a molecular weight of 299.17 g/mol. Its IUPAC name is 9-phenylpurine-2,6-diamine;dihydrochloride.
| Compound Name | 9-phenylpurine-2,6-diamine;dihydrochloride |
|---|---|
| PubChem CID | 141031122 |
| Molecular Formula | C11H12Cl2N6 |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 9-phenylpurine-2,6-diamine;dihydrochloride |
| SMILES | Cl.Cl.Nc1nc(N)c2ncn(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C11H10N6.2ClH/c12-9-8-10(16-11(13)15-9)17(6-14-8)7-4-2-1-3-5-7;;/h1-6H,(H4,12,13,15,16);2*1H |
| InChIKey | ZKGGIWOYHKQMMN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |