C6H11N9 — CID 170001265
9-N-amino-9-N-(methylamino)purine-2,6,9-triamine (PubChem CID 170001265) has the molecular formula C6H11N9 and a molecular weight of 209.22 g/mol. Its IUPAC name is 9-N-amino-9-N-(methylamino)purine-2,6,9-triamine.
| Compound Name | 9-N-amino-9-N-(methylamino)purine-2,6,9-triamine |
|---|---|
| PubChem CID | 170001265 |
| Molecular Formula | C6H11N9 |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 9-N-amino-9-N-(methylamino)purine-2,6,9-triamine |
| SMILES | CNN(N)n1cnc2c(N)nc(N)nc21 |
| InChI | InChI=1S/C6H11N9/c1-10-15(9)14-2-11-3-4(7)12-6(8)13-5(3)14/h2,10H,9H2,1H3,(H4,7,8,12,13) |
| InChIKey | QWIXLUOJHJSSMS-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 136.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|