C9H14N6 — CID 142265839
cyclopropane;9-methylpurine-2,6-diamine (PubChem CID 142265839) has the molecular formula C9H14N6 and a molecular weight of 206.25 g/mol. Its IUPAC name is cyclopropane;9-methylpurine-2,6-diamine.
| Compound Name | cyclopropane;9-methylpurine-2,6-diamine |
|---|---|
| PubChem CID | 142265839 |
| Molecular Formula | C9H14N6 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | cyclopropane;9-methylpurine-2,6-diamine |
| SMILES | C1CC1.Cn1cnc2c(N)nc(N)nc21 |
| InChI | InChI=1S/C6H8N6.C3H6/c1-12-2-9-3-4(7)10-6(8)11-5(3)12;1-2-3-1/h2H,1H3,(H4,7,8,10,11);1-3H2 |
| InChIKey | YYABMJNUPHXZMZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |