About cyclopropane;9-methylpurine-2,6-diamine
cyclopropane;9-methylpurine-2,6-diamine (PubChem CID 142265839) has the molecular formula C9H14N6
and a molecular weight of 206.25 g/mol. Its IUPAC name is cyclopropane;9-methylpurine-2,6-diamine.
Molecular Properties
| Compound Name | cyclopropane;9-methylpurine-2,6-diamine |
| PubChem CID | 142265839 |
| Molecular Formula | C9H14N6 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | cyclopropane;9-methylpurine-2,6-diamine |
| SMILES | C1CC1.Cn1cnc2c(N)nc(N)nc21 |
| InChI | InChI=1S/C6H8N6.C3H6/c1-12-2-9-3-4(7)10-6(8)11-5(3)12;1-2-3-1/h2H,1H3,(H4,7,8,10,11);1-3H2 |
| InChIKey | YYABMJNUPHXZMZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze cyclopropane;9-methylpurine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropane;9-methylpurine-2,6-diamine?
The IUPAC name of cyclopropane;9-methylpurine-2,6-diamine (CID 142265839) is cyclopropane;9-methylpurine-2,6-diamine.
What is the SMILES notation for cyclopropane;9-methylpurine-2,6-diamine?
The canonical SMILES for cyclopropane;9-methylpurine-2,6-diamine is C1CC1.Cn1cnc2c(N)nc(N)nc21.
What is the InChIKey of cyclopropane;9-methylpurine-2,6-diamine?
The InChIKey is YYABMJNUPHXZMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N6.C3H6/c1-12-2-9-3-4(7)10-6(8)11-5(3)12;1-2-3-1/h2H,1H3,(H4,7,8,10,11);1-3H2.
What are the key properties of cyclopropane;9-methylpurine-2,6-diamine?
cyclopropane;9-methylpurine-2,6-diamine has a molecular weight of 206.25 g/mol, XLogP of 0.70, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropane;9-methylpurine-2,6-diamine is sourced from PubChem (CID 142265839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).