C18H27N5O2 — CID 176575034
4-(2-amino-9-methylpurin-6-yl)oxybut-2-yn-1-ol;cyclooctane (PubChem CID 176575034) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 4-(2-amino-9-methylpurin-6-yl)oxybut-2-yn-1-ol;cyclooctane.
| Compound Name | 4-(2-amino-9-methylpurin-6-yl)oxybut-2-yn-1-ol;cyclooctane |
|---|---|
| PubChem CID | 176575034 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 4-(2-amino-9-methylpurin-6-yl)oxybut-2-yn-1-ol;cyclooctane |
| SMILES | C1CCCCCCC1.Cn1cnc2c(OCC#CCO)nc(N)nc21 |
| InChI | InChI=1S/C10H11N5O2.C8H16/c1-15-6-12-7-8(15)13-10(11)14-9(7)17-5-3-2-4-16;1-2-4-6-8-7-5-3-1/h6,16H,4-5H2,1H3,(H2,11,13,14);1-8H2 |
| InChIKey | XRHHWTANRLRPKC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|