C13H12IN5O2 — CID 176574929
[4-[(2-amino-9-iodopurin-6-yl)oxymethyl]phenyl]methanol (PubChem CID 176574929) has the molecular formula C13H12IN5O2 and a molecular weight of 397.18 g/mol. Its IUPAC name is [4-[(2-amino-9-iodopurin-6-yl)oxymethyl]phenyl]methanol.
| Compound Name | [4-[(2-amino-9-iodopurin-6-yl)oxymethyl]phenyl]methanol |
|---|---|
| PubChem CID | 176574929 |
| Molecular Formula | C13H12IN5O2 |
| Molecular Weight | 397.18 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | [4-[(2-amino-9-iodopurin-6-yl)oxymethyl]phenyl]methanol |
| SMILES | Nc1nc(OCc2ccc(CO)cc2)c2ncn(I)c2n1 |
| InChI | InChI=1S/C13H12IN5O2/c14-19-7-16-10-11(19)17-13(15)18-12(10)21-6-9-3-1-8(5-20)2-4-9/h1-4,7,20H,5-6H2,(H2,15,17,18) |
| InChIKey | WZCDRXOEYMEUEI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|