C13H13N5O2 — CID 91583081
(2-amino-6-phenylmethoxypurin-9-yl)methanol (PubChem CID 91583081) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is (2-amino-6-phenylmethoxypurin-9-yl)methanol.
| Compound Name | (2-amino-6-phenylmethoxypurin-9-yl)methanol |
|---|---|
| PubChem CID | 91583081 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | (2-amino-6-phenylmethoxypurin-9-yl)methanol |
| SMILES | Nc1nc(OCc2ccccc2)c2ncn(CO)c2n1 |
| InChI | InChI=1S/C13H13N5O2/c14-13-16-11-10(15-7-18(11)8-19)12(17-13)20-6-9-4-2-1-3-5-9/h1-5,7,19H,6,8H2,(H2,14,16,17) |
| InChIKey | CTGPBIVLSDMVBL-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |