C18H21ClN8O3 — CID 86342466
3-[3-(2-amino-6-phenylmethoxypurin-9-yl)propyl]-1-(2-chloroethyl)-1-nitrosourea (PubChem CID 86342466) has the molecular formula C18H21ClN8O3 and a molecular weight of 432.87 g/mol. Its IUPAC name is 3-[3-(2-amino-6-phenylmethoxypurin-9-yl)propyl]-1-(2-chloroethyl)-1-nitrosourea.
| Compound Name | 3-[3-(2-amino-6-phenylmethoxypurin-9-yl)propyl]-1-(2-chloroethyl)-1-nitrosourea |
|---|---|
| PubChem CID | 86342466 |
| Molecular Formula | C18H21ClN8O3 |
| Molecular Weight | 432.87 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 3-[3-(2-amino-6-phenylmethoxypurin-9-yl)propyl]-1-(2-chloroethyl)-1-nitrosourea |
| SMILES | Nc1nc(OCc2ccccc2)c2ncn(CCCNC(=O)N(CCCl)N=O)c2n1 |
| InChI | InChI=1S/C18H21ClN8O3/c19-7-10-27(25-29)18(28)21-8-4-9-26-12-22-14-15(26)23-17(20)24-16(14)30-11-13-5-2-1-3-6-13/h1-3,5-6,12H,4,7-11H2,(H,21,28)(H2,20,23,24) |
| InChIKey | FWKOOQKWBUIYSC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.87 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|