C15H15N5O3 — CID 10425718
methyl 2-(2-amino-6-phenylmethoxypurin-9-yl)acetate (PubChem CID 10425718) has the molecular formula C15H15N5O3 and a molecular weight of 313.32 g/mol. Its IUPAC name is methyl 2-(2-amino-6-phenylmethoxypurin-9-yl)acetate.
| Compound Name | methyl 2-(2-amino-6-phenylmethoxypurin-9-yl)acetate |
|---|---|
| PubChem CID | 10425718 |
| Molecular Formula | C15H15N5O3 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | methyl 2-(2-amino-6-phenylmethoxypurin-9-yl)acetate |
| SMILES | COC(=O)Cn1cnc2c(OCc3ccccc3)nc(N)nc21 |
| InChI | InChI=1S/C15H15N5O3/c1-22-11(21)7-20-9-17-12-13(20)18-15(16)19-14(12)23-8-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H2,16,18,19) |
| InChIKey | LYQALQRHBAWZAU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |