C20H32N10O2S2 — CID 159212445
2-amino-9-methyl-1H-purin-6-one;9-methyl-6-(propan-2-ylsulfanylmethoxy)purin-2-amine;2-methylsulfanylpropane (PubChem CID 159212445) has the molecular formula C20H32N10O2S2 and a molecular weight of 508.68 g/mol. Its IUPAC name is 2-amino-9-methyl-1H-purin-6-one;9-methyl-6-(propan-2-ylsulfanylmethoxy)purin-2-amine;2-methylsulfanylpropane.
| Compound Name | 2-amino-9-methyl-1H-purin-6-one;9-methyl-6-(propan-2-ylsulfanylmethoxy)purin-2-amine;2-methylsulfanylpropane |
|---|---|
| PubChem CID | 159212445 |
| Molecular Formula | C20H32N10O2S2 |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | 2-amino-9-methyl-1H-purin-6-one;9-methyl-6-(propan-2-ylsulfanylmethoxy)purin-2-amine;2-methylsulfanylpropane |
| SMILES | CC(C)SCOc1nc(N)nc2c1ncn2C.CSC(C)C.Cn1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C10H15N5OS.C6H7N5O.C4H10S/c1-6(2)17-5-16-9-7-8(13-10(11)14-9)15(3)4-12-7;1-11-2-8-3-4(11)9-6(7)10-5(3)12;1-4(2)5-3/h4,6H,5H2,1-3H3,(H2,11,13,14);2H,1H3,(H3,7,9,10,12);4H,1-3H3 |
| InChIKey | KQQVQDZGSOQNKQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 168.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|