C13H20N8O2 — CID 142113883
2-amino-9-methyl-1H-purin-6-one;2-amino-1-methylpyrimidin-4-one;ethane (PubChem CID 142113883) has the molecular formula C13H20N8O2 and a molecular weight of 320.36 g/mol. Its IUPAC name is 2-amino-9-methyl-1H-purin-6-one;2-amino-1-methylpyrimidin-4-one;ethane.
| Compound Name | 2-amino-9-methyl-1H-purin-6-one;2-amino-1-methylpyrimidin-4-one;ethane |
|---|---|
| PubChem CID | 142113883 |
| Molecular Formula | C13H20N8O2 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 2-amino-9-methyl-1H-purin-6-one;2-amino-1-methylpyrimidin-4-one;ethane |
| SMILES | CC.Cn1ccc(=O)nc1N.Cn1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C6H7N5O.C5H7N3O.C2H6/c1-11-2-8-3-4(11)9-6(7)10-5(3)12;1-8-3-2-4(9)7-5(8)6;1-2/h2H,1H3,(H3,7,9,10,12);2-3H,1H3,(H2,6,7,9);1-2H3 |
| InChIKey | QHNFWOAETJLEIJ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 150.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |