C11H11N11O2 — CID 170160535
2-amino-9-[2-amino-6-(methoxyamino)purin-9-yl]-1H-purin-6-one (PubChem CID 170160535) has the molecular formula C11H11N11O2 and a molecular weight of 329.28 g/mol. Its IUPAC name is 2-amino-9-[2-amino-6-(methoxyamino)purin-9-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-amino-6-(methoxyamino)purin-9-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 170160535 |
| Molecular Formula | C11H11N11O2 |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-amino-9-[2-amino-6-(methoxyamino)purin-9-yl]-1H-purin-6-one |
| SMILES | CONc1nc(N)nc2c1ncn2-n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C11H11N11O2/c1-24-20-6-4-7(17-10(12)16-6)21(2-14-4)22-3-15-5-8(22)18-11(13)19-9(5)23/h2-3H,1H3,(H3,12,16,17,20)(H3,13,18,19,23) |
| InChIKey | QIIHHQPQCLIGJZ-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 180.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|