C12H12N10O2 — CID 136657308
2-amino-9-[2-(ethylamino)-6-oxo-1H-purin-9-yl]-1H-purin-6-one (PubChem CID 136657308) has the molecular formula C12H12N10O2 and a molecular weight of 328.30 g/mol. Its IUPAC name is 2-amino-9-[2-(ethylamino)-6-oxo-1H-purin-9-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-(ethylamino)-6-oxo-1H-purin-9-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136657308 |
| Molecular Formula | C12H12N10O2 |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2-amino-9-[2-(ethylamino)-6-oxo-1H-purin-9-yl]-1H-purin-6-one |
| SMILES | CCNc1nc2c(ncn2-n2cnc3c(=O)[nH]c(N)nc32)c(=O)[nH]1 |
| InChI | InChI=1S/C12H12N10O2/c1-2-14-12-18-8-6(10(24)20-12)16-4-22(8)21-3-15-5-7(21)17-11(13)19-9(5)23/h3-4H,2H2,1H3,(H3,13,17,19,23)(H2,14,18,20,24) |
| InChIKey | GNZDOYVOHBZVKQ-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 165.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |