C13H13N5O3 — CID 135491182
2-amino-9-(3,4-dimethoxyphenyl)-1H-purin-6-one (PubChem CID 135491182) has the molecular formula C13H13N5O3 and a molecular weight of 287.28 g/mol. Its IUPAC name is 2-amino-9-(3,4-dimethoxyphenyl)-1H-purin-6-one.
| Compound Name | 2-amino-9-(3,4-dimethoxyphenyl)-1H-purin-6-one |
|---|---|
| PubChem CID | 135491182 |
| Molecular Formula | C13H13N5O3 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2-amino-9-(3,4-dimethoxyphenyl)-1H-purin-6-one |
| SMILES | COc1ccc(-n2cnc3c(=O)[nH]c(N)nc32)cc1OC |
| InChI | InChI=1S/C13H13N5O3/c1-20-8-4-3-7(5-9(8)21-2)18-6-15-10-11(18)16-13(14)17-12(10)19/h3-6H,1-2H3,(H3,14,16,17,19) |
| InChIKey | WTMGRTFPZSBBDN-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |