C13H11BrN6O2 — CID 135482506
N-[3-(2-amino-6-oxo-1H-purin-9-yl)phenyl]-2-bromoacetamide (PubChem CID 135482506) has the molecular formula C13H11BrN6O2 and a molecular weight of 363.18 g/mol. Its IUPAC name is N-[3-(2-amino-6-oxo-1H-purin-9-yl)phenyl]-2-bromoacetamide.
| Compound Name | N-[3-(2-amino-6-oxo-1H-purin-9-yl)phenyl]-2-bromoacetamide |
|---|---|
| PubChem CID | 135482506 |
| Molecular Formula | C13H11BrN6O2 |
| Molecular Weight | 363.18 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | N-[3-(2-amino-6-oxo-1H-purin-9-yl)phenyl]-2-bromoacetamide |
| SMILES | Nc1nc2c(ncn2-c2cccc(NC(=O)CBr)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C13H11BrN6O2/c14-5-9(21)17-7-2-1-3-8(4-7)20-6-16-10-11(20)18-13(15)19-12(10)22/h1-4,6H,5H2,(H,17,21)(H3,15,18,19,22) |
| InChIKey | HYNAZBIWOGXDOH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|