C21H16N6O3 — CID 175882507
N-[3-(2-amino-4,7-dioxo-6-phenyl-3H-pteridin-8-yl)phenyl]prop-2-enamide (PubChem CID 175882507) has the molecular formula C21H16N6O3 and a molecular weight of 400.40 g/mol. Its IUPAC name is N-[3-(2-amino-4,7-dioxo-6-phenyl-3H-pteridin-8-yl)phenyl]prop-2-enamide.
| Compound Name | N-[3-(2-amino-4,7-dioxo-6-phenyl-3H-pteridin-8-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 175882507 |
| Molecular Formula | C21H16N6O3 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | N-[3-(2-amino-4,7-dioxo-6-phenyl-3H-pteridin-8-yl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-n2c(=O)c(-c3ccccc3)nc3c(=O)[nH]c(N)nc32)c1 |
| InChI | InChI=1S/C21H16N6O3/c1-2-15(28)23-13-9-6-10-14(11-13)27-18-17(19(29)26-21(22)25-18)24-16(20(27)30)12-7-4-3-5-8-12/h2-11H,1H2,(H,23,28)(H3,22,25,26,29) |
| InChIKey | TYWSKSBVMNDJGR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 135.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|