C26H26N8O2 — CID 175285409
N-[3-[4-(N-(4-methylpiperazin-1-yl)anilino)-7-oxopteridin-8-yl]phenyl]prop-2-enamide (PubChem CID 175285409) has the molecular formula C26H26N8O2 and a molecular weight of 482.55 g/mol. Its IUPAC name is N-[3-[4-(N-(4-methylpiperazin-1-yl)anilino)-7-oxopteridin-8-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[4-(N-(4-methylpiperazin-1-yl)anilino)-7-oxopteridin-8-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 175285409 |
| Molecular Formula | C26H26N8O2 |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | N-[3-[4-(N-(4-methylpiperazin-1-yl)anilino)-7-oxopteridin-8-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-n2c(=O)cnc3c(N(c4ccccc4)N4CCN(C)CC4)ncnc32)c1 |
| InChI | InChI=1S/C26H26N8O2/c1-3-22(35)30-19-8-7-11-21(16-19)33-23(36)17-27-24-25(33)28-18-29-26(24)34(20-9-5-4-6-10-20)32-14-12-31(2)13-15-32/h3-11,16-18H,1,12-15H2,2H3,(H,30,35) |
| InChIKey | HHFYAXZIEYDCJB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|