C23H21N7O3 — CID 163969656
N-[3-[2-[(4-acetamidocyclohexa-1,3-dien-1-yl)amino]-7-oxopteridin-8-yl]phenyl]prop-2-enamide (PubChem CID 163969656) has the molecular formula C23H21N7O3 and a molecular weight of 443.47 g/mol. Its IUPAC name is N-[3-[2-[(4-acetamidocyclohexa-1,3-dien-1-yl)amino]-7-oxopteridin-8-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[2-[(4-acetamidocyclohexa-1,3-dien-1-yl)amino]-7-oxopteridin-8-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 163969656 |
| Molecular Formula | C23H21N7O3 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | N-[3-[2-[(4-acetamidocyclohexa-1,3-dien-1-yl)amino]-7-oxopteridin-8-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-n2c(=O)cnc3cnc(NC4=CC=C(NC(C)=O)CC4)nc32)c1 |
| InChI | InChI=1S/C23H21N7O3/c1-3-20(32)27-17-5-4-6-18(11-17)30-21(33)13-24-19-12-25-23(29-22(19)30)28-16-9-7-15(8-10-16)26-14(2)31/h3-7,9,11-13H,1,8,10H2,2H3,(H,26,31)(H,27,32)(H,25,28,29) |
| InChIKey | SOWSKQQSBOGNHS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|