C30H25FN6O4 — CID 166625820
N-[3-[6-(2-fluorophenyl)-2-[4-(2-methoxyethoxy)anilino]-7-oxopteridin-8-yl]phenyl]prop-2-enamide (PubChem CID 166625820) has the molecular formula C30H25FN6O4 and a molecular weight of 552.57 g/mol. Its IUPAC name is N-[3-[6-(2-fluorophenyl)-2-[4-(2-methoxyethoxy)anilino]-7-oxopteridin-8-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[6-(2-fluorophenyl)-2-[4-(2-methoxyethoxy)anilino]-7-oxopteridin-8-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166625820 |
| Molecular Formula | C30H25FN6O4 |
| Molecular Weight | 552.57 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | N-[3-[6-(2-fluorophenyl)-2-[4-(2-methoxyethoxy)anilino]-7-oxopteridin-8-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-n2c(=O)c(-c3ccccc3F)nc3cnc(Nc4ccc(OCCOC)cc4)nc32)c1 |
| InChI | InChI=1S/C30H25FN6O4/c1-3-26(38)33-20-7-6-8-21(17-20)37-28-25(35-27(29(37)39)23-9-4-5-10-24(23)31)18-32-30(36-28)34-19-11-13-22(14-12-19)41-16-15-40-2/h3-14,17-18H,1,15-16H2,2H3,(H,33,38)(H,32,34,36) |
| InChIKey | IJONDZVYIBNTDX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.57 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|