C27H28FN5O4 — CID 146344605
N-[3-[[7-fluoro-4-[4-(2-methoxyethoxy)anilino]-1,1-dimethyl-3-oxo-2H-pyrrolo[3,4-c]pyridin-6-yl]amino]phenyl]prop-2-enamide (PubChem CID 146344605) has the molecular formula C27H28FN5O4 and a molecular weight of 505.55 g/mol. Its IUPAC name is N-[3-[[7-fluoro-4-[4-(2-methoxyethoxy)anilino]-1,1-dimethyl-3-oxo-2H-pyrrolo[3,4-c]pyridin-6-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[7-fluoro-4-[4-(2-methoxyethoxy)anilino]-1,1-dimethyl-3-oxo-2H-pyrrolo[3,4-c]pyridin-6-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146344605 |
| Molecular Formula | C27H28FN5O4 |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | N-[3-[[7-fluoro-4-[4-(2-methoxyethoxy)anilino]-1,1-dimethyl-3-oxo-2H-pyrrolo[3,4-c]pyridin-6-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc(OCCOC)cc3)c3c(c2F)C(C)(C)NC3=O)c1 |
| InChI | InChI=1S/C27H28FN5O4/c1-5-20(34)29-17-7-6-8-18(15-17)31-25-23(28)22-21(26(35)33-27(22,2)3)24(32-25)30-16-9-11-19(12-10-16)37-14-13-36-4/h5-12,15H,1,13-14H2,2-4H3,(H,29,34)(H,33,35)(H2,30,31,32) |
| InChIKey | ILQZUHJBPQMRAN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 113.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|