C27H28F2N8O2 — CID 122475208
N-[3-[2-[2,3-difluoro-4-[4-(2-methoxyethyl)piperazin-1-yl]anilino]purin-9-yl]phenyl]prop-2-enamide (PubChem CID 122475208) has the molecular formula C27H28F2N8O2 and a molecular weight of 534.57 g/mol. Its IUPAC name is N-[3-[2-[2,3-difluoro-4-[4-(2-methoxyethyl)piperazin-1-yl]anilino]purin-9-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[2-[2,3-difluoro-4-[4-(2-methoxyethyl)piperazin-1-yl]anilino]purin-9-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122475208 |
| Molecular Formula | C27H28F2N8O2 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | N-[3-[2-[2,3-difluoro-4-[4-(2-methoxyethyl)piperazin-1-yl]anilino]purin-9-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-n2cnc3cnc(Nc4ccc(N5CCN(CCOC)CC5)c(F)c4F)nc32)c1 |
| InChI | InChI=1S/C27H28F2N8O2/c1-3-23(38)32-18-5-4-6-19(15-18)37-17-31-21-16-30-27(34-26(21)37)33-20-7-8-22(25(29)24(20)28)36-11-9-35(10-12-36)13-14-39-2/h3-8,15-17H,1,9-14H2,2H3,(H,32,38)(H,30,33,34) |
| InChIKey | RHNOTIHUCOSOLO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|