C28H29FN8O3 — CID 122475531
N-[3-[2-[2-fluoro-4-[4-(2-hydroxypropyl)piperazin-1-yl]anilino]-5-oxopyrimido[4,5-d]pyrimidin-8-yl]phenyl]prop-2-enamide (PubChem CID 122475531) has the molecular formula C28H29FN8O3 and a molecular weight of 544.59 g/mol. Its IUPAC name is N-[3-[2-[2-fluoro-4-[4-(2-hydroxypropyl)piperazin-1-yl]anilino]-5-oxopyrimido[4,5-d]pyrimidin-8-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[2-[2-fluoro-4-[4-(2-hydroxypropyl)piperazin-1-yl]anilino]-5-oxopyrimido[4,5-d]pyrimidin-8-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122475531 |
| Molecular Formula | C28H29FN8O3 |
| Molecular Weight | 544.59 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | N-[3-[2-[2-fluoro-4-[4-(2-hydroxypropyl)piperazin-1-yl]anilino]-5-oxopyrimido[4,5-d]pyrimidin-8-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-n2cnc(=O)c3cnc(Nc4ccc(N5CCN(CC(C)O)CC5)cc4F)nc32)c1 |
| InChI | InChI=1S/C28H29FN8O3/c1-3-25(39)32-19-5-4-6-21(13-19)37-17-31-27(40)22-15-30-28(34-26(22)37)33-24-8-7-20(14-23(24)29)36-11-9-35(10-12-36)16-18(2)38/h3-8,13-15,17-18,38H,1,9-12,16H2,2H3,(H,32,39)(H,30,33,34) |
| InChIKey | KTKWPPDJCNILGI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.59 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|