C27H27ClN8O3 — CID 122474521
N-[3-[2-[3-chloro-4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]-5-oxopyrimido[4,5-d]pyrimidin-8-yl]phenyl]prop-2-enamide (PubChem CID 122474521) has the molecular formula C27H27ClN8O3 and a molecular weight of 547.02 g/mol. Its IUPAC name is N-[3-[2-[3-chloro-4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]-5-oxopyrimido[4,5-d]pyrimidin-8-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[2-[3-chloro-4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]-5-oxopyrimido[4,5-d]pyrimidin-8-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122474521 |
| Molecular Formula | C27H27ClN8O3 |
| Molecular Weight | 547.02 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | N-[3-[2-[3-chloro-4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]-5-oxopyrimido[4,5-d]pyrimidin-8-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-n2cnc(=O)c3cnc(Nc4ccc(N5CCN(CCO)CC5)c(Cl)c4)nc32)c1 |
| InChI | InChI=1S/C27H27ClN8O3/c1-2-24(38)31-18-4-3-5-20(14-18)36-17-30-26(39)21-16-29-27(33-25(21)36)32-19-6-7-23(22(28)15-19)35-10-8-34(9-11-35)12-13-37/h2-7,14-17,37H,1,8-13H2,(H,31,38)(H,29,32,33) |
| InChIKey | ARPRDVJILBHMME-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.02 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|