C28H30ClN7O2 — CID 164911770
N-[1-[5-chloro-2-[3-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]pyrimidin-4-yl]-3-methylindol-5-yl]prop-2-enamide (PubChem CID 164911770) has the molecular formula C28H30ClN7O2 and a molecular weight of 532.05 g/mol. Its IUPAC name is N-[1-[5-chloro-2-[3-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]pyrimidin-4-yl]-3-methylindol-5-yl]prop-2-enamide.
| Compound Name | N-[1-[5-chloro-2-[3-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]pyrimidin-4-yl]-3-methylindol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 164911770 |
| Molecular Formula | C28H30ClN7O2 |
| Molecular Weight | 532.05 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | N-[1-[5-chloro-2-[3-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]pyrimidin-4-yl]-3-methylindol-5-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc2c(c1)c(C)cn2-c1nc(Nc2cccc(N3CCN(CCO)CC3)c2)ncc1Cl |
| InChI | InChI=1S/C28H30ClN7O2/c1-3-26(38)31-21-7-8-25-23(16-21)19(2)18-36(25)27-24(29)17-30-28(33-27)32-20-5-4-6-22(15-20)35-11-9-34(10-12-35)13-14-37/h3-8,15-18,37H,1,9-14H2,2H3,(H,31,38)(H,30,32,33) |
| InChIKey | NSRILIWNFQSIST-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.05 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|