C19H17ClN8O — CID 171725524
N-[1-[5-chloro-2-[(3-methyltriazol-4-yl)amino]pyrimidin-4-yl]-3-methylindol-5-yl]prop-2-enamide (PubChem CID 171725524) has the molecular formula C19H17ClN8O and a molecular weight of 408.85 g/mol. Its IUPAC name is N-[1-[5-chloro-2-[(3-methyltriazol-4-yl)amino]pyrimidin-4-yl]-3-methylindol-5-yl]prop-2-enamide.
| Compound Name | N-[1-[5-chloro-2-[(3-methyltriazol-4-yl)amino]pyrimidin-4-yl]-3-methylindol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 171725524 |
| Molecular Formula | C19H17ClN8O |
| Molecular Weight | 408.85 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | N-[1-[5-chloro-2-[(3-methyltriazol-4-yl)amino]pyrimidin-4-yl]-3-methylindol-5-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc2c(c1)c(C)cn2-c1nc(Nc2cnnn2C)ncc1Cl |
| InChI | InChI=1S/C19H17ClN8O/c1-4-17(29)23-12-5-6-15-13(7-12)11(2)10-28(15)18-14(20)8-21-19(25-18)24-16-9-22-26-27(16)3/h4-10H,1H2,2-3H3,(H,23,29)(H,21,24,25) |
| InChIKey | UACROSCBJPUZGZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 102.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.85 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|