C22H22FN7O2 — CID 164911694
N-[1-[5-fluoro-2-[[1-[(2S)-2-hydroxypropyl]pyrazol-4-yl]amino]pyrimidin-4-yl]-3-methylindol-5-yl]prop-2-enamide (PubChem CID 164911694) has the molecular formula C22H22FN7O2 and a molecular weight of 435.46 g/mol. Its IUPAC name is N-[1-[5-fluoro-2-[[1-[(2S)-2-hydroxypropyl]pyrazol-4-yl]amino]pyrimidin-4-yl]-3-methylindol-5-yl]prop-2-enamide.
| Compound Name | N-[1-[5-fluoro-2-[[1-[(2S)-2-hydroxypropyl]pyrazol-4-yl]amino]pyrimidin-4-yl]-3-methylindol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 164911694 |
| Molecular Formula | C22H22FN7O2 |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | N-[1-[5-fluoro-2-[[1-[(2S)-2-hydroxypropyl]pyrazol-4-yl]amino]pyrimidin-4-yl]-3-methylindol-5-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc2c(c1)c(C)cn2-c1nc(Nc2cnn(C[C@H](C)O)c2)ncc1F |
| InChI | InChI=1S/C22H22FN7O2/c1-4-20(32)26-15-5-6-19-17(7-15)13(2)10-30(19)21-18(23)9-24-22(28-21)27-16-8-25-29(12-16)11-14(3)31/h4-10,12,14,31H,1,11H2,2-3H3,(H,26,32)(H,24,27,28)/t14-/m0/s1 |
| InChIKey | JUKAQUMDTFDZJX-AWEZNQCLSA-N |
| XLogP | 3.31 |
| TPSA | 109.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|