C24H23ClN6O2 — CID 156804778
N-[1-[2-(4-amino-2-ethoxyanilino)-5-chloropyrimidin-4-yl]-3-methylindol-5-yl]prop-2-enamide (PubChem CID 156804778) has the molecular formula C24H23ClN6O2 and a molecular weight of 462.94 g/mol. Its IUPAC name is N-[1-[2-(4-amino-2-ethoxyanilino)-5-chloropyrimidin-4-yl]-3-methylindol-5-yl]prop-2-enamide.
| Compound Name | N-[1-[2-(4-amino-2-ethoxyanilino)-5-chloropyrimidin-4-yl]-3-methylindol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 156804778 |
| Molecular Formula | C24H23ClN6O2 |
| Molecular Weight | 462.94 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | N-[1-[2-(4-amino-2-ethoxyanilino)-5-chloropyrimidin-4-yl]-3-methylindol-5-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc2c(c1)c(C)cn2-c1nc(Nc2ccc(N)cc2OCC)ncc1Cl |
| InChI | InChI=1S/C24H23ClN6O2/c1-4-22(32)28-16-7-9-20-17(11-16)14(3)13-31(20)23-18(25)12-27-24(30-23)29-19-8-6-15(26)10-21(19)33-5-2/h4,6-13H,1,5,26H2,2-3H3,(H,28,32)(H,27,29,30) |
| InChIKey | YXRGVIZTJMGFRZ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.94 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|