C27H27ClN6O3 — CID 164911818
N-[1-[5-chloro-2-(2-ethoxy-4-morpholin-4-ylanilino)pyrimidin-4-yl]indol-5-yl]prop-2-enamide (PubChem CID 164911818) has the molecular formula C27H27ClN6O3 and a molecular weight of 519.01 g/mol. Its IUPAC name is N-[1-[5-chloro-2-(2-ethoxy-4-morpholin-4-ylanilino)pyrimidin-4-yl]indol-5-yl]prop-2-enamide.
| Compound Name | N-[1-[5-chloro-2-(2-ethoxy-4-morpholin-4-ylanilino)pyrimidin-4-yl]indol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 164911818 |
| Molecular Formula | C27H27ClN6O3 |
| Molecular Weight | 519.01 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | N-[1-[5-chloro-2-(2-ethoxy-4-morpholin-4-ylanilino)pyrimidin-4-yl]indol-5-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc2c(ccn2-c2nc(Nc3ccc(N4CCOCC4)cc3OCC)ncc2Cl)c1 |
| InChI | InChI=1S/C27H27ClN6O3/c1-3-25(35)30-19-5-8-23-18(15-19)9-10-34(23)26-21(28)17-29-27(32-26)31-22-7-6-20(16-24(22)37-4-2)33-11-13-36-14-12-33/h3,5-10,15-17H,1,4,11-14H2,2H3,(H,30,35)(H,29,31,32) |
| InChIKey | DJWNEFHRVYAVOW-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.01 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|