C24H26N6O2S — CID 73438269
N-[3-[[5-methylsulfanyl-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 73438269) has the molecular formula C24H26N6O2S and a molecular weight of 462.58 g/mol. Its IUPAC name is N-[3-[[5-methylsulfanyl-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[5-methylsulfanyl-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 73438269 |
| Molecular Formula | C24H26N6O2S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | N-[3-[[5-methylsulfanyl-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc(N4CCOCC4)cc3)ncc2SC)c1 |
| InChI | InChI=1S/C24H26N6O2S/c1-3-22(31)26-18-5-4-6-19(15-18)27-23-21(33-2)16-25-24(29-23)28-17-7-9-20(10-8-17)30-11-13-32-14-12-30/h3-10,15-16H,1,11-14H2,2H3,(H,26,31)(H2,25,27,28,29) |
| InChIKey | YCVQQORGOKSWJU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|