C24H21FN6O2 — CID 123294983
N-[3-[5-cyano-2-(3-morpholin-4-ylanilino)pyrimidin-4-yl]-4-fluorophenyl]prop-2-enamide (PubChem CID 123294983) has the molecular formula C24H21FN6O2 and a molecular weight of 444.47 g/mol. Its IUPAC name is N-[3-[5-cyano-2-(3-morpholin-4-ylanilino)pyrimidin-4-yl]-4-fluorophenyl]prop-2-enamide.
| Compound Name | N-[3-[5-cyano-2-(3-morpholin-4-ylanilino)pyrimidin-4-yl]-4-fluorophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 123294983 |
| Molecular Formula | C24H21FN6O2 |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | N-[3-[5-cyano-2-(3-morpholin-4-ylanilino)pyrimidin-4-yl]-4-fluorophenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(F)c(-c2nc(Nc3cccc(N4CCOCC4)c3)ncc2C#N)c1 |
| InChI | InChI=1S/C24H21FN6O2/c1-2-22(32)28-18-6-7-21(25)20(13-18)23-16(14-26)15-27-24(30-23)29-17-4-3-5-19(12-17)31-8-10-33-11-9-31/h2-7,12-13,15H,1,8-11H2,(H,28,32)(H,27,29,30) |
| InChIKey | LHOIKSYETWITIF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|