C25H21F3N6O3 — CID 118361567
N-[2-cyano-5-[2-(3-morpholin-4-ylanilino)-5-(trifluoromethoxy)pyrimidin-4-yl]phenyl]prop-2-enamide (PubChem CID 118361567) has the molecular formula C25H21F3N6O3 and a molecular weight of 510.48 g/mol. Its IUPAC name is N-[2-cyano-5-[2-(3-morpholin-4-ylanilino)-5-(trifluoromethoxy)pyrimidin-4-yl]phenyl]prop-2-enamide.
| Compound Name | N-[2-cyano-5-[2-(3-morpholin-4-ylanilino)-5-(trifluoromethoxy)pyrimidin-4-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118361567 |
| Molecular Formula | C25H21F3N6O3 |
| Molecular Weight | 510.48 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | N-[2-cyano-5-[2-(3-morpholin-4-ylanilino)-5-(trifluoromethoxy)pyrimidin-4-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2nc(Nc3cccc(N4CCOCC4)c3)ncc2OC(F)(F)F)ccc1C#N |
| InChI | InChI=1S/C25H21F3N6O3/c1-2-22(35)32-20-12-16(6-7-17(20)14-29)23-21(37-25(26,27)28)15-30-24(33-23)31-18-4-3-5-19(13-18)34-8-10-36-11-9-34/h2-7,12-13,15H,1,8-11H2,(H,32,35)(H,30,31,33) |
| InChIKey | KQSKAQSRFRXAMI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|