C25H24N6O3 — CID 123407762
N-[3-[5-cyano-2-(3-morpholin-4-ylanilino)pyrimidin-4-yl]-5-methoxyphenyl]prop-2-enamide (PubChem CID 123407762) has the molecular formula C25H24N6O3 and a molecular weight of 456.51 g/mol. Its IUPAC name is N-[3-[5-cyano-2-(3-morpholin-4-ylanilino)pyrimidin-4-yl]-5-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[3-[5-cyano-2-(3-morpholin-4-ylanilino)pyrimidin-4-yl]-5-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 123407762 |
| Molecular Formula | C25H24N6O3 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | N-[3-[5-cyano-2-(3-morpholin-4-ylanilino)pyrimidin-4-yl]-5-methoxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(OC)cc(-c2nc(Nc3cccc(N4CCOCC4)c3)ncc2C#N)c1 |
| InChI | InChI=1S/C25H24N6O3/c1-3-23(32)28-20-11-17(12-22(14-20)33-2)24-18(15-26)16-27-25(30-24)29-19-5-4-6-21(13-19)31-7-9-34-10-8-31/h3-6,11-14,16H,1,7-10H2,2H3,(H,28,32)(H,27,29,30) |
| InChIKey | CPCLZFDRPJZBMQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|