C24H21FN6O3 — CID 118361419
N-[3-[5-cyano-2-(4-hydroxy-3-morpholin-4-ylanilino)pyrimidin-4-yl]-5-fluorophenyl]prop-2-enamide (PubChem CID 118361419) has the molecular formula C24H21FN6O3 and a molecular weight of 460.47 g/mol. Its IUPAC name is N-[3-[5-cyano-2-(4-hydroxy-3-morpholin-4-ylanilino)pyrimidin-4-yl]-5-fluorophenyl]prop-2-enamide.
| Compound Name | N-[3-[5-cyano-2-(4-hydroxy-3-morpholin-4-ylanilino)pyrimidin-4-yl]-5-fluorophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118361419 |
| Molecular Formula | C24H21FN6O3 |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | N-[3-[5-cyano-2-(4-hydroxy-3-morpholin-4-ylanilino)pyrimidin-4-yl]-5-fluorophenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(F)cc(-c2nc(Nc3ccc(O)c(N4CCOCC4)c3)ncc2C#N)c1 |
| InChI | InChI=1S/C24H21FN6O3/c1-2-22(33)28-19-10-15(9-17(25)11-19)23-16(13-26)14-27-24(30-23)29-18-3-4-21(32)20(12-18)31-5-7-34-8-6-31/h2-4,9-12,14,32H,1,5-8H2,(H,28,33)(H,27,29,30) |
| InChIKey | FQUUNYNSMPRJIZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|