C31H31FN6O3 — CID 154987332
N-[3-[6-anilino-2-[4-hydroxy-3-(1,4-oxazepan-4-yl)anilino]-5H-1,3-diazepin-4-yl]-5-fluorophenyl]prop-2-enamide (PubChem CID 154987332) has the molecular formula C31H31FN6O3 and a molecular weight of 554.63 g/mol. Its IUPAC name is N-[3-[6-anilino-2-[4-hydroxy-3-(1,4-oxazepan-4-yl)anilino]-5H-1,3-diazepin-4-yl]-5-fluorophenyl]prop-2-enamide.
| Compound Name | N-[3-[6-anilino-2-[4-hydroxy-3-(1,4-oxazepan-4-yl)anilino]-5H-1,3-diazepin-4-yl]-5-fluorophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 154987332 |
| Molecular Formula | C31H31FN6O3 |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | N-[3-[6-anilino-2-[4-hydroxy-3-(1,4-oxazepan-4-yl)anilino]-5H-1,3-diazepin-4-yl]-5-fluorophenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(F)cc(C2=NC(Nc3ccc(O)c(N4CCCOCC4)c3)=NC=C(Nc3ccccc3)C2)c1 |
| InChI | InChI=1S/C31H31FN6O3/c1-2-30(40)35-25-16-21(15-22(32)17-25)27-18-26(34-23-7-4-3-5-8-23)20-33-31(37-27)36-24-9-10-29(39)28(19-24)38-11-6-13-41-14-12-38/h2-5,7-10,15-17,19-20,34,39H,1,6,11-14,18H2,(H,33,36)(H,35,40) |
| InChIKey | VLHNMRAGQAIDGR-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 110.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|