C29H29FN6O3 — CID 154987259
N-[5-[5-(cyclohexa-1,5-dien-1-ylamino)-2-(4-hydroxy-3-morpholin-4-ylanilino)pyrimidin-4-yl]-2-fluorophenyl]prop-2-enamide (PubChem CID 154987259) has the molecular formula C29H29FN6O3 and a molecular weight of 528.59 g/mol. Its IUPAC name is N-[5-[5-(cyclohexa-1,5-dien-1-ylamino)-2-(4-hydroxy-3-morpholin-4-ylanilino)pyrimidin-4-yl]-2-fluorophenyl]prop-2-enamide.
| Compound Name | N-[5-[5-(cyclohexa-1,5-dien-1-ylamino)-2-(4-hydroxy-3-morpholin-4-ylanilino)pyrimidin-4-yl]-2-fluorophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 154987259 |
| Molecular Formula | C29H29FN6O3 |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | N-[5-[5-(cyclohexa-1,5-dien-1-ylamino)-2-(4-hydroxy-3-morpholin-4-ylanilino)pyrimidin-4-yl]-2-fluorophenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2nc(Nc3ccc(O)c(N4CCOCC4)c3)ncc2NC2=CCCC=C2)ccc1F |
| InChI | InChI=1S/C29H29FN6O3/c1-2-27(38)34-23-16-19(8-10-22(23)30)28-24(32-20-6-4-3-5-7-20)18-31-29(35-28)33-21-9-11-26(37)25(17-21)36-12-14-39-15-13-36/h2,4,6-11,16-18,32,37H,1,3,5,12-15H2,(H,34,38)(H,31,33,35) |
| InChIKey | JCISQCOFAOWDPG-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|