C26H23F2N5O2 — CID 122475643
N-[3-[3-(2,3-difluoro-4-morpholin-4-ylanilino)pyrrolo[1,2-a]pyrazin-6-yl]phenyl]prop-2-enamide (PubChem CID 122475643) has the molecular formula C26H23F2N5O2 and a molecular weight of 475.50 g/mol. Its IUPAC name is N-[3-[3-(2,3-difluoro-4-morpholin-4-ylanilino)pyrrolo[1,2-a]pyrazin-6-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[3-(2,3-difluoro-4-morpholin-4-ylanilino)pyrrolo[1,2-a]pyrazin-6-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122475643 |
| Molecular Formula | C26H23F2N5O2 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | N-[3-[3-(2,3-difluoro-4-morpholin-4-ylanilino)pyrrolo[1,2-a]pyrazin-6-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2ccc3cnc(Nc4ccc(N5CCOCC5)c(F)c4F)cn23)c1 |
| InChI | InChI=1S/C26H23F2N5O2/c1-2-24(34)30-18-5-3-4-17(14-18)21-8-6-19-15-29-23(16-33(19)21)31-20-7-9-22(26(28)25(20)27)32-10-12-35-13-11-32/h2-9,14-16,31H,1,10-13H2,(H,30,34) |
| InChIKey | GBOHDXCQGHZUPN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|