C25H24F2N8O — CID 122475265
N-[3-[2-[2,3-difluoro-4-(4-methylpiperazin-1-yl)anilino]imidazo[5,1-f][1,2,4]triazin-7-yl]phenyl]prop-2-enamide (PubChem CID 122475265) has the molecular formula C25H24F2N8O and a molecular weight of 490.52 g/mol. Its IUPAC name is N-[3-[2-[2,3-difluoro-4-(4-methylpiperazin-1-yl)anilino]imidazo[5,1-f][1,2,4]triazin-7-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[2-[2,3-difluoro-4-(4-methylpiperazin-1-yl)anilino]imidazo[5,1-f][1,2,4]triazin-7-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122475265 |
| Molecular Formula | C25H24F2N8O |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | N-[3-[2-[2,3-difluoro-4-(4-methylpiperazin-1-yl)anilino]imidazo[5,1-f][1,2,4]triazin-7-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2ncc3cnc(Nc4ccc(N5CCN(C)CC5)c(F)c4F)nn23)c1 |
| InChI | InChI=1S/C25H24F2N8O/c1-3-21(36)30-17-6-4-5-16(13-17)24-28-14-18-15-29-25(32-35(18)24)31-19-7-8-20(23(27)22(19)26)34-11-9-33(2)10-12-34/h3-8,13-15H,1,9-12H2,2H3,(H,30,36)(H,31,32) |
| InChIKey | UKZDWLGBFWNXHT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 90.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|