C25H22F2N6O2 — CID 122475833
N-[3-[2-(2,3-difluoro-4-morpholin-4-ylanilino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]prop-2-enamide (PubChem CID 122475833) has the molecular formula C25H22F2N6O2 and a molecular weight of 476.49 g/mol. Its IUPAC name is N-[3-[2-(2,3-difluoro-4-morpholin-4-ylanilino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[2-(2,3-difluoro-4-morpholin-4-ylanilino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122475833 |
| Molecular Formula | C25H22F2N6O2 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | N-[3-[2-(2,3-difluoro-4-morpholin-4-ylanilino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2ccc3cnc(Nc4ccc(N5CCOCC5)c(F)c4F)nn23)c1 |
| InChI | InChI=1S/C25H22F2N6O2/c1-2-22(34)29-17-5-3-4-16(14-17)20-8-6-18-15-28-25(31-33(18)20)30-19-7-9-21(24(27)23(19)26)32-10-12-35-13-11-32/h2-9,14-15H,1,10-13H2,(H,29,34)(H,30,31) |
| InChIKey | VBLBQPPDYLXQNF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|